C14H20ClN3OS — CID 1477148
(2S)-2-[(4-chlorophenyl)carbamothioylamino]-N,3,3-trimethylbutanamide (PubChem CID 1477148) has the molecular formula C14H20ClN3OS and a molecular weight of 313.85 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)carbamothioylamino]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)carbamothioylamino]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 1477148 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)carbamothioylamino]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](NC(=S)Nc1ccc(Cl)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H20ClN3OS/c1-14(2,3)11(12(19)16-4)18-13(20)17-10-7-5-9(15)6-8-10/h5-8,11H,1-4H3,(H,16,19)(H2,17,18,20)/t11-/m1/s1 |
| InChIKey | XJLSEZMYJNDTAL-LLVKDONJSA-N |
| XLogP | 2.79 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|