C20H24ClN3O2S — CID 8635561
1-[[(2R)-2-(4-tert-butylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea (PubChem CID 8635561) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 1-[[(2R)-2-(4-tert-butylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[[(2R)-2-(4-tert-butylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 8635561 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-[[(2R)-2-(4-tert-butylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea |
| SMILES | C[C@@H](Oc1ccc(C(C)(C)C)cc1)C(=O)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O2S/c1-13(26-17-11-5-14(6-12-17)20(2,3)4)18(25)23-24-19(27)22-16-9-7-15(21)8-10-16/h5-13H,1-4H3,(H,23,25)(H2,22,24,27)/t13-/m1/s1 |
| InChIKey | HBGYQVJPILXWSP-CYBMUJFWSA-N |
| XLogP | 4.42 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|