C18H20N4O2S — CID 10021177
2-acetamido-N-benzyl-2-(phenylcarbamothioylamino)acetamide (PubChem CID 10021177) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-acetamido-N-benzyl-2-(phenylcarbamothioylamino)acetamide.
| Compound Name | 2-acetamido-N-benzyl-2-(phenylcarbamothioylamino)acetamide |
|---|---|
| PubChem CID | 10021177 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-acetamido-N-benzyl-2-(phenylcarbamothioylamino)acetamide |
| SMILES | CC(=O)NC(NC(=S)Nc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H20N4O2S/c1-13(23)20-16(17(24)19-12-14-8-4-2-5-9-14)22-18(25)21-15-10-6-3-7-11-15/h2-11,16H,12H2,1H3,(H,19,24)(H,20,23)(H2,21,22,25) |
| InChIKey | ROMMIKCAWQKPCB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|