C18H21N5O2S — CID 55350809
1-[1-[2-(benzylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]-3-phenylurea (PubChem CID 55350809) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-[1-[2-(benzylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]-3-phenylurea.
| Compound Name | 1-[1-[2-(benzylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 55350809 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[1-[2-(benzylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]-3-phenylurea |
| SMILES | CC(NC(=O)Nc1ccccc1)C(=O)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C18H21N5O2S/c1-13(20-17(25)21-15-10-6-3-7-11-15)16(24)22-23-18(26)19-12-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3,(H,22,24)(H2,19,23,26)(H2,20,21,25) |
| InChIKey | SKSQVVTZXCPFET-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|