C20H22F2N4O2S — CID 40706020
N-[(2S)-1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide (PubChem CID 40706020) has the molecular formula C20H22F2N4O2S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[(2S)-1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[(2S)-1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 40706020 |
| Molecular Formula | C20H22F2N4O2S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[(2S)-1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1c(F)cccc1F)C(=O)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C20H22F2N4O2S/c1-12(2)17(24-18(27)16-14(21)9-6-10-15(16)22)19(28)25-26-20(29)23-11-13-7-4-3-5-8-13/h3-10,12,17H,11H2,1-2H3,(H,24,27)(H,25,28)(H2,23,26,29)/t17-/m0/s1 |
| InChIKey | AWQIZMVRDMZXGM-KRWDZBQOSA-N |
| XLogP | 2.41 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|