C20H23FN4O2S — CID 18228792
N-[1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 18228792) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 18228792 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[1-[2-(benzylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(F)cc1)C(=O)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C20H23FN4O2S/c1-13(2)17(23-18(26)15-8-10-16(21)11-9-15)19(27)24-25-20(28)22-12-14-6-4-3-5-7-14/h3-11,13,17H,12H2,1-2H3,(H,23,26)(H,24,27)(H2,22,25,28) |
| InChIKey | GAZFOQGQAKCUCT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|