C15H21FN4O2S — CID 8942492
N-[(2R)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide (PubChem CID 8942492) has the molecular formula C15H21FN4O2S and a molecular weight of 340.42 g/mol. Its IUPAC name is N-[(2R)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 8942492 |
| Molecular Formula | C15H21FN4O2S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[(2R)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C(=O)NNC(=S)NCc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C15H21FN4O2S/c1-9(2)13(18-10(3)21)14(22)19-20-15(23)17-8-11-4-6-12(16)7-5-11/h4-7,9,13H,8H2,1-3H3,(H,18,21)(H,19,22)(H2,17,20,23)/t13-/m1/s1 |
| InChIKey | QVCBFTKIQBNQKU-CYBMUJFWSA-N |
| XLogP | 0.98 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|