C15H22FN5O2S — CID 8942230
[(2S,3S)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea (PubChem CID 8942230) has the molecular formula C15H22FN5O2S and a molecular weight of 355.44 g/mol. Its IUPAC name is [(2S,3S)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea.
| Compound Name | [(2S,3S)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 8942230 |
| Molecular Formula | C15H22FN5O2S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [(2S,3S)-1-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FN5O2S/c1-3-9(2)12(19-14(17)23)13(22)20-21-15(24)18-8-10-4-6-11(16)7-5-10/h4-7,9,12H,3,8H2,1-2H3,(H,20,22)(H3,17,19,23)(H2,18,21,24)/t9-,12-/m0/s1 |
| InChIKey | NHRDAWRDRFFXQT-CABZTGNLSA-N |
| XLogP | 0.90 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|