C21H24F2N4O2S — CID 55350899
N-[1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide (PubChem CID 55350899) has the molecular formula C21H24F2N4O2S and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 55350899 |
| Molecular Formula | C21H24F2N4O2S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
| SMILES | Cc1cccc(NC(=S)NNC(=O)C(NC(=O)c2c(F)cccc2F)C(C)C)c1C |
| InChI | InChI=1S/C21H24F2N4O2S/c1-11(2)18(25-19(28)17-14(22)8-6-9-15(17)23)20(29)26-27-21(30)24-16-10-5-7-12(3)13(16)4/h5-11,18H,1-4H3,(H,25,28)(H,26,29)(H2,24,27,30) |
| InChIKey | VJMCQKKZXWXEMS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|