C22H28N4O2S — CID 7613220
N-[(2S,3S)-1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 7613220) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[(2S,3S)-1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3S)-1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 7613220 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[(2S,3S)-1-[2-[(2,3-dimethylphenyl)carbamothioyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1)C(=O)NNC(=S)Nc1cccc(C)c1C |
| InChI | InChI=1S/C22H28N4O2S/c1-5-14(2)19(24-20(27)17-11-7-6-8-12-17)21(28)25-26-22(29)23-18-13-9-10-15(3)16(18)4/h6-14,19H,5H2,1-4H3,(H,24,27)(H,25,28)(H2,23,26,29)/t14-,19-/m0/s1 |
| InChIKey | ZFGHJOXBVJMSRI-LIRRHRJNSA-N |
| XLogP | 3.47 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|