C21H27N3O4S — CID 9257354
N-[(2S,3S)-1-(2,3-dimethyl-5-sulfamoylanilino)-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 9257354) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[(2S,3S)-1-(2,3-dimethyl-5-sulfamoylanilino)-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3S)-1-(2,3-dimethyl-5-sulfamoylanilino)-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 9257354 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[(2S,3S)-1-(2,3-dimethyl-5-sulfamoylanilino)-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1)C(=O)Nc1cc(S(N)(=O)=O)cc(C)c1C |
| InChI | InChI=1S/C21H27N3O4S/c1-5-13(2)19(24-20(25)16-9-7-6-8-10-16)21(26)23-18-12-17(29(22,27)28)11-14(3)15(18)4/h6-13,19H,5H2,1-4H3,(H,23,26)(H,24,25)(H2,22,27,28)/t13-,19-/m0/s1 |
| InChIKey | YEKAFGCXCZJXBW-DJJJIMSYSA-N |
| XLogP | 2.73 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |