C18H21N3O5S — CID 9257612
ethyl N-[3-[(2,3-dimethyl-5-sulfamoylphenyl)carbamoyl]phenyl]carbamate (PubChem CID 9257612) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is ethyl N-[3-[(2,3-dimethyl-5-sulfamoylphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[(2,3-dimethyl-5-sulfamoylphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9257612 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | ethyl N-[3-[(2,3-dimethyl-5-sulfamoylphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(C(=O)Nc2cc(S(N)(=O)=O)cc(C)c2C)c1 |
| InChI | InChI=1S/C18H21N3O5S/c1-4-26-18(23)20-14-7-5-6-13(9-14)17(22)21-16-10-15(27(19,24)25)8-11(2)12(16)3/h5-10H,4H2,1-3H3,(H,20,23)(H,21,22)(H2,19,24,25) |
| InChIKey | OHJLDZTUHFOTAN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |