C21H28N2O5S — CID 9141581
4-butoxy-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-ethoxybenzamide (PubChem CID 9141581) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-butoxy-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-ethoxybenzamide.
| Compound Name | 4-butoxy-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-ethoxybenzamide |
|---|---|
| PubChem CID | 9141581 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-butoxy-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-ethoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc(S(N)(=O)=O)cc(C)c2C)cc1OCC |
| InChI | InChI=1S/C21H28N2O5S/c1-5-7-10-28-19-9-8-16(12-20(19)27-6-2)21(24)23-18-13-17(29(22,25)26)11-14(3)15(18)4/h8-9,11-13H,5-7,10H2,1-4H3,(H,23,24)(H2,22,25,26) |
| InChIKey | ZECAFBXUCKSFDD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|