C13H21N3O3S — CID 60654305
1-butyl-3-(2,3-dimethyl-5-sulfamoylphenyl)urea (PubChem CID 60654305) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-butyl-3-(2,3-dimethyl-5-sulfamoylphenyl)urea.
| Compound Name | 1-butyl-3-(2,3-dimethyl-5-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 60654305 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-butyl-3-(2,3-dimethyl-5-sulfamoylphenyl)urea |
| SMILES | CCCCNC(=O)Nc1cc(S(N)(=O)=O)cc(C)c1C |
| InChI | InChI=1S/C13H21N3O3S/c1-4-5-6-15-13(17)16-12-8-11(20(14,18)19)7-9(2)10(12)3/h7-8H,4-6H2,1-3H3,(H2,14,18,19)(H2,15,16,17) |
| InChIKey | PBGWIJWIYLIYIT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|