C12H17ClN2O3S — CID 62727374
3-chloro-N-(2,3-dimethyl-5-sulfamoylphenyl)-2-methylpropanamide (PubChem CID 62727374) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dimethyl-5-sulfamoylphenyl)-2-methylpropanamide.
| Compound Name | 3-chloro-N-(2,3-dimethyl-5-sulfamoylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62727374 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-chloro-N-(2,3-dimethyl-5-sulfamoylphenyl)-2-methylpropanamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)C(C)CCl)c1C |
| InChI | InChI=1S/C12H17ClN2O3S/c1-7-4-10(19(14,17)18)5-11(9(7)3)15-12(16)8(2)6-13/h4-5,8H,6H2,1-3H3,(H,15,16)(H2,14,17,18) |
| InChIKey | MGPYYLQRQJQXMI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|