C12H20N2O2S — CID 43684700
3,4-dimethyl-5-(2-methylpropylamino)benzenesulfonamide (PubChem CID 43684700) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 3,4-dimethyl-5-(2-methylpropylamino)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-5-(2-methylpropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43684700 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3,4-dimethyl-5-(2-methylpropylamino)benzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NCC(C)C)c1C |
| InChI | InChI=1S/C12H20N2O2S/c1-8(2)7-14-12-6-11(17(13,15)16)5-9(3)10(12)4/h5-6,8,14H,7H2,1-4H3,(H2,13,15,16) |
| InChIKey | PYQIHUHARSWEIY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |