C15H18N2O3S — CID 43684675
3-[(4-hydroxyphenyl)methylamino]-4,5-dimethylbenzenesulfonamide (PubChem CID 43684675) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methylamino]-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-[(4-hydroxyphenyl)methylamino]-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43684675 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methylamino]-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NCc2ccc(O)cc2)c1C |
| InChI | InChI=1S/C15H18N2O3S/c1-10-7-14(21(16,19)20)8-15(11(10)2)17-9-12-3-5-13(18)6-4-12/h3-8,17-18H,9H2,1-2H3,(H2,16,19,20) |
| InChIKey | HIHIVMFSEKXMDT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |