C17H22N2O4S2 — CID 9241775
3,4-dimethyl-5-[(4-propylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 9241775) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(4-propylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-5-[(4-propylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 9241775 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3,4-dimethyl-5-[(4-propylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)Nc2cc(S(N)(=O)=O)cc(C)c2C)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-4-5-14-6-8-15(9-7-14)25(22,23)19-17-11-16(24(18,20)21)10-12(2)13(17)3/h6-11,19H,4-5H2,1-3H3,(H2,18,20,21) |
| InChIKey | XOBKAVDYBRLCDX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |