C14H14Cl2N2O4S2 — CID 9241661
3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide (PubChem CID 9241661) has the molecular formula C14H14Cl2N2O4S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 9241661 |
| Molecular Formula | C14H14Cl2N2O4S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C14H14Cl2N2O4S2/c1-8-5-11(23(17,19)20)7-14(9(8)2)18-24(21,22)10-3-4-12(15)13(16)6-10/h3-7,18H,1-2H3,(H2,17,19,20) |
| InChIKey | ULZQSNJAZRYIIJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |