C16H20N2O4S2 — CID 9241717
3-[(2,4-dimethylphenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide (PubChem CID 9241717) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 9241717 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfonylamino]-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(S(N)(=O)=O)cc(C)c2C)c(C)c1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-10-5-6-16(12(3)7-10)24(21,22)18-15-9-14(23(17,19)20)8-11(2)13(15)4/h5-9,18H,1-4H3,(H2,17,19,20) |
| InChIKey | NWIXGNYQOIZICI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |