C13H21N3O3S — CID 60671270
N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(propan-2-ylamino)acetamide (PubChem CID 60671270) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(propan-2-ylamino)acetamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(propan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 60671270 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-(propan-2-ylamino)acetamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(C)C)c1C |
| InChI | InChI=1S/C13H21N3O3S/c1-8(2)15-7-13(17)16-12-6-11(20(14,18)19)5-9(3)10(12)4/h5-6,8,15H,7H2,1-4H3,(H,16,17)(H2,14,18,19) |
| InChIKey | KKCPTGICNQCCRD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |