About N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride
N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride (PubChem CID 119689597) has the molecular formula C14H22ClN3O3S
and a molecular weight of 347.87 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride |
| PubChem CID | 119689597 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)CC2CCCN2)c1C.Cl |
| InChI | InChI=1S/C14H21N3O3S.ClH/c1-9-6-12(21(15,19)20)8-13(10(9)2)17-14(18)7-11-4-3-5-16-11;/h6,8,11,16H,3-5,7H2,1-2H3,(H,17,18)(H2,15,19,20);1H |
| InChIKey | FVIWHWOEAYRXHI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride?
The IUPAC name of N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride (CID 119689597) is N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride.
What is the SMILES notation for N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride?
The canonical SMILES for N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride is Cc1cc(S(N)(=O)=O)cc(NC(=O)CC2CCCN2)c1C.Cl.
What is the InChIKey of N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride?
The InChIKey is FVIWHWOEAYRXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S.ClH/c1-9-6-12(21(15,19)20)8-13(10(9)2)17-14(18)7-11-4-3-5-16-11;/h6,8,11,16H,3-5,7H2,1-2H3,(H,17,18)(H2,15,19,20);1H.
What are the key properties of N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride?
N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride has a molecular weight of 347.87 g/mol, XLogP of 1.45, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethyl-5-sulfamoylphenyl)-2-pyrrolidin-2-ylacetamide;hydrochloride is sourced from PubChem (CID 119689597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).