C16H23ClN2O5S — CID 119814750
ethyl 3-methylsulfonyl-5-[(2-pyrrolidin-2-ylacetyl)amino]benzoate;hydrochloride (PubChem CID 119814750) has the molecular formula C16H23ClN2O5S and a molecular weight of 390.89 g/mol. Its IUPAC name is ethyl 3-methylsulfonyl-5-[(2-pyrrolidin-2-ylacetyl)amino]benzoate;hydrochloride.
| Compound Name | ethyl 3-methylsulfonyl-5-[(2-pyrrolidin-2-ylacetyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119814750 |
| Molecular Formula | C16H23ClN2O5S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | ethyl 3-methylsulfonyl-5-[(2-pyrrolidin-2-ylacetyl)amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(NC(=O)CC2CCCN2)cc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C16H22N2O5S.ClH/c1-3-23-16(20)11-7-13(9-14(8-11)24(2,21)22)18-15(19)10-12-5-4-6-17-12;/h7-9,12,17H,3-6,10H2,1-2H3,(H,18,19);1H |
| InChIKey | XXZILOIXIZKHTK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |