C17H25ClN2O6S — CID 120936583
ethyl 3-[[4-(aminomethyl)oxane-4-carbonyl]amino]-5-methylsulfonylbenzoate;hydrochloride (PubChem CID 120936583) has the molecular formula C17H25ClN2O6S and a molecular weight of 420.92 g/mol. Its IUPAC name is ethyl 3-[[4-(aminomethyl)oxane-4-carbonyl]amino]-5-methylsulfonylbenzoate;hydrochloride.
| Compound Name | ethyl 3-[[4-(aminomethyl)oxane-4-carbonyl]amino]-5-methylsulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120936583 |
| Molecular Formula | C17H25ClN2O6S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | ethyl 3-[[4-(aminomethyl)oxane-4-carbonyl]amino]-5-methylsulfonylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(NC(=O)C2(CN)CCOCC2)cc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C17H24N2O6S.ClH/c1-3-25-15(20)12-8-13(10-14(9-12)26(2,22)23)19-16(21)17(11-18)4-6-24-7-5-17;/h8-10H,3-7,11,18H2,1-2H3,(H,19,21);1H |
| InChIKey | XVTHJIDYNSAFLT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |