C14H20N2O4S — CID 115439460
ethyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 115439460) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 115439460 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 2-[[4-(aminomethyl)oxane-4-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)C1(CN)CCOCC1 |
| InChI | InChI=1S/C14H20N2O4S/c1-2-20-12(17)10-3-8-21-11(10)16-13(18)14(9-15)4-6-19-7-5-14/h3,8H,2,4-7,9,15H2,1H3,(H,16,18) |
| InChIKey | HTPUXFBGXQRMJX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |