C20H26N4O4 — CID 120925521
ethyl 1-[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]-5-methylpyrazole-4-carboxylate (PubChem CID 120925521) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 1-[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 120925521 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethyl 1-[3-[[4-(aminomethyl)oxane-4-carbonyl]amino]phenyl]-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(NC(=O)C3(CN)CCOCC3)c2)c1C |
| InChI | InChI=1S/C20H26N4O4/c1-3-28-18(25)17-12-22-24(14(17)2)16-6-4-5-15(11-16)23-19(26)20(13-21)7-9-27-10-8-20/h4-6,11-12H,3,7-10,13,21H2,1-2H3,(H,23,26) |
| InChIKey | CENDYNZAGVHSJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |