C16H21ClN4O3 — CID 119294307
ethyl 1-[3-(3-aminopropanoylamino)phenyl]-5-methylpyrazole-4-carboxylate;hydrochloride (PubChem CID 119294307) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is ethyl 1-[3-(3-aminopropanoylamino)phenyl]-5-methylpyrazole-4-carboxylate;hydrochloride.
| Compound Name | ethyl 1-[3-(3-aminopropanoylamino)phenyl]-5-methylpyrazole-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119294307 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | ethyl 1-[3-(3-aminopropanoylamino)phenyl]-5-methylpyrazole-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnn(-c2cccc(NC(=O)CCN)c2)c1C.Cl |
| InChI | InChI=1S/C16H20N4O3.ClH/c1-3-23-16(22)14-10-18-20(11(14)2)13-6-4-5-12(9-13)19-15(21)7-8-17;/h4-6,9-10H,3,7-8,17H2,1-2H3,(H,19,21);1H |
| InChIKey | SWPGQGVKTKOSOB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |