C23H21N5O4 — CID 33256895
ethyl 5-methyl-1-[3-[[2-(1-oxophthalazin-2-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate (PubChem CID 33256895) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is ethyl 5-methyl-1-[3-[[2-(1-oxophthalazin-2-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[3-[[2-(1-oxophthalazin-2-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 33256895 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | ethyl 5-methyl-1-[3-[[2-(1-oxophthalazin-2-yl)acetyl]amino]phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(NC(=O)Cn3ncc4ccccc4c3=O)c2)c1C |
| InChI | InChI=1S/C23H21N5O4/c1-3-32-23(31)20-13-25-28(15(20)2)18-9-6-8-17(11-18)26-21(29)14-27-22(30)19-10-5-4-7-16(19)12-24-27/h4-13H,3,14H2,1-2H3,(H,26,29) |
| InChIKey | XFLZAHAGDGOQLV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |