C19H19N3O4 — CID 55878594
N-[3-(2-methoxyethoxy)phenyl]-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 55878594) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[3-(2-methoxyethoxy)phenyl]-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[3-(2-methoxyethoxy)phenyl]-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 55878594 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[3-(2-methoxyethoxy)phenyl]-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | COCCOc1cccc(NC(=O)Cn2ncc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-25-9-10-26-16-7-4-6-15(11-16)21-18(23)13-22-19(24)17-8-3-2-5-14(17)12-20-22/h2-8,11-12H,9-10,13H2,1H3,(H,21,23) |
| InChIKey | LWKIZJOYKCPFAY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|