C16H16N4O2 — CID 22693446
2-(6-aminoindazol-1-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 22693446) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(6-aminoindazol-1-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(6-aminoindazol-1-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22693446 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(6-aminoindazol-1-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)Cn2ncc3ccc(N)cc32)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-22-14-4-2-3-13(8-14)19-16(21)10-20-15-7-12(17)6-5-11(15)9-18-20/h2-9H,10,17H2,1H3,(H,19,21) |
| InChIKey | LBILSGZRRFAWDJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|