C16H14N4O3 — CID 22693487
2-(6-aminoindazol-1-yl)-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 22693487) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(6-aminoindazol-1-yl)-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-(6-aminoindazol-1-yl)-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 22693487 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(6-aminoindazol-1-yl)-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | Nc1ccc2cnn(CC(=O)Nc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C16H14N4O3/c17-11-2-1-10-7-18-20(13(10)5-11)8-16(21)19-12-3-4-14-15(6-12)23-9-22-14/h1-7H,8-9,17H2,(H,19,21) |
| InChIKey | MNIXFOZIGHGQKX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|