C13H14N4O3 — CID 65356994
4-amino-N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-5-carboxamide (PubChem CID 65356994) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-amino-N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65356994 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-amino-N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14N4O3/c1-2-17-12(9(14)6-15-17)13(18)16-8-3-4-10-11(5-8)20-7-19-10/h3-6H,2,7,14H2,1H3,(H,16,18) |
| InChIKey | PQIKEADHUCGAIS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |