C12H11N3O3 — CID 6470985
N-(1,3-benzodioxol-5-yl)-2-methylpyrazole-3-carboxamide (PubChem CID 6470985) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6470985 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11N3O3/c1-15-9(4-5-13-15)12(16)14-8-2-3-10-11(6-8)18-7-17-10/h2-6H,7H2,1H3,(H,14,16) |
| InChIKey | PDIGLVOXXHQAHD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |