C21H19N5O4 — CID 6089356
N-[4-[(Z)-N-(1,3-benzodioxole-5-carbonylamino)-C-methylcarbonimidoyl]phenyl]-2-methylpyrazole-3-carboxamide (PubChem CID 6089356) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[4-[(Z)-N-(1,3-benzodioxole-5-carbonylamino)-C-methylcarbonimidoyl]phenyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-[(Z)-N-(1,3-benzodioxole-5-carbonylamino)-C-methylcarbonimidoyl]phenyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6089356 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[4-[(Z)-N-(1,3-benzodioxole-5-carbonylamino)-C-methylcarbonimidoyl]phenyl]-2-methylpyrazole-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc2c(c1)OCO2)c1ccc(NC(=O)c2ccnn2C)cc1 |
| InChI | InChI=1S/C21H19N5O4/c1-13(24-25-20(27)15-5-8-18-19(11-15)30-12-29-18)14-3-6-16(7-4-14)23-21(28)17-9-10-22-26(17)2/h3-11H,12H2,1-2H3,(H,23,28)(H,25,27)/b24-13- |
| InChIKey | KARFCGLRYJQWIJ-CFRMEGHHSA-N |
| XLogP | 2.56 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|