C12H12N4O2 — CID 6466922
N-(4-carbamoylphenyl)-2-methylpyrazole-3-carboxamide (PubChem CID 6466922) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6466922 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-(4-carbamoylphenyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C12H12N4O2/c1-16-10(6-7-14-16)12(18)15-9-4-2-8(3-5-9)11(13)17/h2-7H,1H3,(H2,13,17)(H,15,18) |
| InChIKey | ZFUWTFPSGNMKKW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |