C16H23ClN2O5S — CID 119341449
methyl 3-[(1-aminocyclohexanecarbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride (PubChem CID 119341449) has the molecular formula C16H23ClN2O5S and a molecular weight of 390.89 g/mol. Its IUPAC name is methyl 3-[(1-aminocyclohexanecarbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride.
| Compound Name | methyl 3-[(1-aminocyclohexanecarbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119341449 |
| Molecular Formula | C16H23ClN2O5S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 3-[(1-aminocyclohexanecarbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(NC(=O)C2(N)CCCCC2)cc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C16H22N2O5S.ClH/c1-23-14(19)11-8-12(10-13(9-11)24(2,21)22)18-15(20)16(17)6-4-3-5-7-16;/h8-10H,3-7,17H2,1-2H3,(H,18,20);1H |
| InChIKey | UTSSHZWIEJZFCG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |