C15H22N2O5S — CID 119814799
methyl 3-[(2-amino-2-methylpentanoyl)amino]-5-methylsulfonylbenzoate (PubChem CID 119814799) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 3-[(2-amino-2-methylpentanoyl)amino]-5-methylsulfonylbenzoate.
| Compound Name | methyl 3-[(2-amino-2-methylpentanoyl)amino]-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 119814799 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 3-[(2-amino-2-methylpentanoyl)amino]-5-methylsulfonylbenzoate |
| SMILES | CCCC(C)(N)C(=O)Nc1cc(C(=O)OC)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-5-6-15(2,16)14(19)17-11-7-10(13(18)22-3)8-12(9-11)23(4,20)21/h7-9H,5-6,16H2,1-4H3,(H,17,19) |
| InChIKey | DUVLNVPIYSTWKI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |