C16H23ClN2O6S — CID 119814788
methyl 3-[(4-methoxypiperidine-4-carbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride (PubChem CID 119814788) has the molecular formula C16H23ClN2O6S and a molecular weight of 406.89 g/mol. Its IUPAC name is methyl 3-[(4-methoxypiperidine-4-carbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride.
| Compound Name | methyl 3-[(4-methoxypiperidine-4-carbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119814788 |
| Molecular Formula | C16H23ClN2O6S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | methyl 3-[(4-methoxypiperidine-4-carbonyl)amino]-5-methylsulfonylbenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(NC(=O)C2(OC)CCNCC2)cc(S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C16H22N2O6S.ClH/c1-23-14(19)11-8-12(10-13(9-11)25(3,21)22)18-15(20)16(24-2)4-6-17-7-5-16;/h8-10,17H,4-7H2,1-3H3,(H,18,20);1H |
| InChIKey | FFXSQXPRJRILBS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |