C20H25ClN4O3 — CID 119700736
4-methoxy-N-[4-(phenylcarbamoylamino)phenyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 119700736) has the molecular formula C20H25ClN4O3 and a molecular weight of 404.90 g/mol. Its IUPAC name is 4-methoxy-N-[4-(phenylcarbamoylamino)phenyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-methoxy-N-[4-(phenylcarbamoylamino)phenyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119700736 |
| Molecular Formula | C20H25ClN4O3 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-methoxy-N-[4-(phenylcarbamoylamino)phenyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc2)CCNCC1.Cl |
| InChI | InChI=1S/C20H24N4O3.ClH/c1-27-20(11-13-21-14-12-20)18(25)22-16-7-9-17(10-8-16)24-19(26)23-15-5-3-2-4-6-15;/h2-10,21H,11-14H2,1H3,(H,22,25)(H2,23,24,26);1H |
| InChIKey | QDMZCNQRLFNUKZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |