C18H24Cl2N4O2 — CID 119870640
N-(6-anilino-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride (PubChem CID 119870640) has the molecular formula C18H24Cl2N4O2 and a molecular weight of 399.32 g/mol. Its IUPAC name is N-(6-anilino-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-(6-anilino-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119870640 |
| Molecular Formula | C18H24Cl2N4O2 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-(6-anilino-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride |
| SMILES | COC1(C(=O)Nc2ccc(Nc3ccccc3)nc2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H22N4O2.2ClH/c1-24-18(9-11-19-12-10-18)17(23)22-15-7-8-16(20-13-15)21-14-5-3-2-4-6-14;;/h2-8,13,19H,9-12H2,1H3,(H,20,21)(H,22,23);2*1H |
| InChIKey | TWWJRHCGGGJCPV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |