C19H24Cl2N4O3 — CID 119893893
N-(6-benzamido-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride (PubChem CID 119893893) has the molecular formula C19H24Cl2N4O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is N-(6-benzamido-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride.
| Compound Name | N-(6-benzamido-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119893893 |
| Molecular Formula | C19H24Cl2N4O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(6-benzamido-3-pyridinyl)-4-methoxypiperidine-4-carboxamide;dihydrochloride |
| SMILES | COC1(C(=O)Nc2ccc(NC(=O)c3ccccc3)nc2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H22N4O3.2ClH/c1-26-19(9-11-20-12-10-19)18(25)22-15-7-8-16(21-13-15)23-17(24)14-5-3-2-4-6-14;;/h2-8,13,20H,9-12H2,1H3,(H,22,25)(H,21,23,24);2*1H |
| InChIKey | BRGNKMDXJQQVEF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |