C13H17NO7S2 — CID 119257906
3-[(2-methyl-2-methylsulfonylpropanoyl)amino]-5-methylsulfonylbenzoic acid (PubChem CID 119257906) has the molecular formula C13H17NO7S2 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[(2-methyl-2-methylsulfonylpropanoyl)amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 3-[(2-methyl-2-methylsulfonylpropanoyl)amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 119257906 |
| Molecular Formula | C13H17NO7S2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 3-[(2-methyl-2-methylsulfonylpropanoyl)amino]-5-methylsulfonylbenzoic acid |
| SMILES | CC(C)(C(=O)Nc1cc(C(=O)O)cc(S(C)(=O)=O)c1)S(C)(=O)=O |
| InChI | InChI=1S/C13H17NO7S2/c1-13(2,23(4,20)21)12(17)14-9-5-8(11(15)16)6-10(7-9)22(3,18)19/h5-7H,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | YCJNRTKYUKSOJM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |