C15H17N3O5S — CID 119257679
3-methylsulfonyl-5-[(5-propan-2-yl-1H-pyrazole-3-carbonyl)amino]benzoic acid (PubChem CID 119257679) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-methylsulfonyl-5-[(5-propan-2-yl-1H-pyrazole-3-carbonyl)amino]benzoic acid.
| Compound Name | 3-methylsulfonyl-5-[(5-propan-2-yl-1H-pyrazole-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 119257679 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-methylsulfonyl-5-[(5-propan-2-yl-1H-pyrazole-3-carbonyl)amino]benzoic acid |
| SMILES | CC(C)c1cc(C(=O)Nc2cc(C(=O)O)cc(S(C)(=O)=O)c2)n[nH]1 |
| InChI | InChI=1S/C15H17N3O5S/c1-8(2)12-7-13(18-17-12)14(19)16-10-4-9(15(20)21)5-11(6-10)24(3,22)23/h4-8H,1-3H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | QEIAOCBVPNEDGT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |