C13H14N4O5S — CID 138044154
3-methylsulfonyl-5-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid (PubChem CID 138044154) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is 3-methylsulfonyl-5-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid.
| Compound Name | 3-methylsulfonyl-5-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 138044154 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-methylsulfonyl-5-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
| SMILES | CC(C(=O)Nc1cc(C(=O)O)cc(S(C)(=O)=O)c1)n1cncn1 |
| InChI | InChI=1S/C13H14N4O5S/c1-8(17-7-14-6-15-17)12(18)16-10-3-9(13(19)20)4-11(5-10)23(2,21)22/h3-8H,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | VXYHEMPDCVNZTN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |