C12H12N4O4 — CID 61405860
5-hydroxy-2-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid (PubChem CID 61405860) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-hydroxy-2-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid.
| Compound Name | 5-hydroxy-2-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 61405860 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-hydroxy-2-[2-(1,2,4-triazol-1-yl)propanoylamino]benzoic acid |
| SMILES | CC(C(=O)Nc1ccc(O)cc1C(=O)O)n1cncn1 |
| InChI | InChI=1S/C12H12N4O4/c1-7(16-6-13-5-14-16)11(18)15-10-3-2-8(17)4-9(10)12(19)20/h2-7,17H,1H3,(H,15,18)(H,19,20) |
| InChIKey | RZHVARFPKIVGSP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|