C11H12FN5O3S — CID 61130531
N-(2-fluoro-4-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 61130531) has the molecular formula C11H12FN5O3S and a molecular weight of 313.31 g/mol. Its IUPAC name is N-(2-fluoro-4-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-(2-fluoro-4-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 61130531 |
| Molecular Formula | C11H12FN5O3S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-(2-fluoro-4-sulfamoylphenyl)-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(S(N)(=O)=O)cc1F)n1cncn1 |
| InChI | InChI=1S/C11H12FN5O3S/c1-7(17-6-14-5-15-17)11(18)16-10-3-2-8(4-9(10)12)21(13,19)20/h2-7H,1H3,(H,16,18)(H2,13,19,20) |
| InChIKey | ILBRJPSVBDRTQX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |