C11H10N4O4 — CID 61405729
5-hydroxy-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]benzoic acid (PubChem CID 61405729) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 5-hydroxy-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]benzoic acid.
| Compound Name | 5-hydroxy-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61405729 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-hydroxy-2-[[2-(1,2,4-triazol-1-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(Cn1cncn1)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C11H10N4O4/c16-7-1-2-9(8(3-7)11(18)19)14-10(17)4-15-6-12-5-13-15/h1-3,5-6,16H,4H2,(H,14,17)(H,18,19) |
| InChIKey | JFULXIXMORMHDU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|