C14H14N4O3 — CID 76907460
3-[3-methyl-4-[[2-(1,2,4-triazol-1-yl)acetyl]amino]phenyl]prop-2-enoic acid (PubChem CID 76907460) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[3-methyl-4-[[2-(1,2,4-triazol-1-yl)acetyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methyl-4-[[2-(1,2,4-triazol-1-yl)acetyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907460 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-[3-methyl-4-[[2-(1,2,4-triazol-1-yl)acetyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C14H14N4O3/c1-10-6-11(3-5-14(20)21)2-4-12(10)17-13(19)7-18-9-15-8-16-18/h2-6,8-9H,7H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | HGSJXMRWEHWVEW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|