C13H16N2O3 — CID 79153655
3-[4-(dimethylcarbamoylamino)-3-methylphenyl]prop-2-enoic acid (PubChem CID 79153655) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[4-(dimethylcarbamoylamino)-3-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(dimethylcarbamoylamino)-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79153655 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-[4-(dimethylcarbamoylamino)-3-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1NC(=O)N(C)C |
| InChI | InChI=1S/C13H16N2O3/c1-9-8-10(5-7-12(16)17)4-6-11(9)14-13(18)15(2)3/h4-8H,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | SRWACRJKDJCKKJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|