C14H12N2O4 — CID 76907432
3-[3-methyl-4-(1,2-oxazole-5-carbonylamino)phenyl]prop-2-enoic acid (PubChem CID 76907432) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-[3-methyl-4-(1,2-oxazole-5-carbonylamino)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methyl-4-(1,2-oxazole-5-carbonylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907432 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-[3-methyl-4-(1,2-oxazole-5-carbonylamino)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)ccc1NC(=O)c1ccno1 |
| InChI | InChI=1S/C14H12N2O4/c1-9-8-10(3-5-13(17)18)2-4-11(9)16-14(19)12-6-7-15-20-12/h2-8H,1H3,(H,16,19)(H,17,18) |
| InChIKey | VRXHUKSXDQUFLZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|